C10H12O6 — CID 46928522
(1S,4R)-4-(1,3-dimethoxy-1,3-dioxopropan-2-yl)cyclobut-2-ene-1-carboxylic acid (PubChem CID 46928522) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is (1S,4R)-4-(1,3-dimethoxy-1,3-dioxopropan-2-yl)cyclobut-2-ene-1-carboxylic acid.
| Compound Name | (1S,4R)-4-(1,3-dimethoxy-1,3-dioxopropan-2-yl)cyclobut-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 46928522 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (1S,4R)-4-(1,3-dimethoxy-1,3-dioxopropan-2-yl)cyclobut-2-ene-1-carboxylic acid |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1C=C[C@@H]1C(=O)O |
| InChI | InChI=1S/C10H12O6/c1-15-9(13)7(10(14)16-2)5-3-4-6(5)8(11)12/h3-7H,1-2H3,(H,11,12)/t5-,6+/m1/s1 |
| InChIKey | PBGBRWGISHCWGB-RITPCOANSA-N |
| XLogP | -0.16 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|