C25H21ClF6NO2Sb — CID 46928906
8-(4-chlorophenyl)-2,3-dimethoxy-5,6-dihydroisoquinolino[1,2-a]isoquinolin-7-ium;hexafluoroantimony(1-) (PubChem CID 46928906) has the molecular formula C25H21ClF6NO2Sb and a molecular weight of 638.65 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-2,3-dimethoxy-5,6-dihydroisoquinolino[1,2-a]isoquinolin-7-ium;hexafluoroantimony(1-).
| Compound Name | 8-(4-chlorophenyl)-2,3-dimethoxy-5,6-dihydroisoquinolino[1,2-a]isoquinolin-7-ium;hexafluoroantimony(1-) |
|---|---|
| PubChem CID | 46928906 |
| Molecular Formula | C25H21ClF6NO2Sb |
| Molecular Weight | 638.65 g/mol |
| Exact Mass | 637.02 |
| IUPAC Name | 8-(4-chlorophenyl)-2,3-dimethoxy-5,6-dihydroisoquinolino[1,2-a]isoquinolin-7-ium;hexafluoroantimony(1-) |
| SMILES | COc1cc2c(cc1OC)-c1c3ccccc3cc(-c3ccc(Cl)cc3)[n+]1CC2.F[Sb-](F)(F)(F)(F)F |
| InChI | InChI=1S/C25H21ClNO2.6FH.Sb/c1-28-23-14-18-11-12-27-22(16-7-9-19(26)10-8-16)13-17-5-3-4-6-20(17)25(27)21(18)15-24(23)29-2;;;;;;;/h3-10,13-15H,11-12H2,1-2H3;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | DKHGJZPIUHJHIV-UHFFFAOYSA-H |
| XLogP | 7.83 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.65 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|