C22H16ClFN6 — CID 46928953
1-(3-chloro-2-fluorophenyl)-2-(7H-purin-6-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 46928953) has the molecular formula C22H16ClFN6 and a molecular weight of 418.86 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-2-(7H-purin-6-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-2-(7H-purin-6-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 46928953 |
| Molecular Formula | C22H16ClFN6 |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-2-(7H-purin-6-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Fc1c(Cl)cccc1C1c2[nH]c3ccccc3c2CCN1c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C22H16ClFN6/c23-15-6-3-5-14(17(15)24)20-18-13(12-4-1-2-7-16(12)29-18)8-9-30(20)22-19-21(26-10-25-19)27-11-28-22/h1-7,10-11,20,29H,8-9H2,(H,25,26,27,28) |
| InChIKey | UCJNTXNLFIUJAE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|