C21H17Cl3F3N5O5 — CID 46929232
2-[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]-N-[1-(2,3-dichlorophenyl)-2-nitroethyl]acetamide (PubChem CID 46929232) has the molecular formula C21H17Cl3F3N5O5 and a molecular weight of 582.75 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]-N-[1-(2,3-dichlorophenyl)-2-nitroethyl]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]-N-[1-(2,3-dichlorophenyl)-2-nitroethyl]acetamide |
|---|---|
| PubChem CID | 46929232 |
| Molecular Formula | C21H17Cl3F3N5O5 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 581.02 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]-N-[1-(2,3-dichlorophenyl)-2-nitroethyl]acetamide |
| SMILES | O=C(Cn1nc(-c2ccc(Cl)cc2)n(C[C@H](O)C(F)(F)F)c1=O)NC(C[N+](=O)[O-])c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H17Cl3F3N5O5/c22-12-6-4-11(5-7-12)19-29-31(20(35)30(19)9-16(33)21(25,26)27)10-17(34)28-15(8-32(36)37)13-2-1-3-14(23)18(13)24/h1-7,15-16,33H,8-10H2,(H,28,34)/t15?,16-/m0/s1 |
| InChIKey | WBNOSCVSXHMUIG-LYKKTTPLSA-N |
| XLogP | 3.73 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|