About 5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole
5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole (PubChem CID 4692925) has the molecular formula C29H31NO
and a molecular weight of 409.57 g/mol. Its IUPAC name is 5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole.
Molecular Properties
| Compound Name | 5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole |
| PubChem CID | 4692925 |
| Molecular Formula | C29H31NO |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole |
| SMILES | CC(C)(C)C1=CC(=C2C=C(c3ccccc3)C(c3ccccc3)=N2)C=C(C(C)(C)C)O1 |
| InChI | InChI=1S/C29H31NO/c1-28(2,3)25-17-22(18-26(31-25)29(4,5)6)24-19-23(20-13-9-7-10-14-20)27(30-24)21-15-11-8-12-16-21/h7-19H,1-6H3 |
| InChIKey | WKCQFKXGSCPSJJ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole?
The IUPAC name of 5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole (CID 4692925) is 5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole.
What is the SMILES notation for 5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole?
The canonical SMILES for 5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole is CC(C)(C)C1=CC(=C2C=C(c3ccccc3)C(c3ccccc3)=N2)C=C(C(C)(C)C)O1.
What is the InChIKey of 5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole?
The InChIKey is WKCQFKXGSCPSJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H31NO/c1-28(2,3)25-17-22(18-26(31-25)29(4,5)6)24-19-23(20-13-9-7-10-14-20)27(30-24)21-15-11-8-12-16-21/h7-19H,1-6H3.
What are the key properties of 5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole?
5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole has a molecular weight of 409.57 g/mol, XLogP of 7.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-ditert-butylpyran-4-ylidene)-2,3-diphenylpyrrole is sourced from PubChem (CID 4692925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).