C22H20O5 — CID 46930026
3-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-4-(4-hydroxyphenyl)furan-2,5-dione (PubChem CID 46930026) has the molecular formula C22H20O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-4-(4-hydroxyphenyl)furan-2,5-dione.
| Compound Name | 3-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-4-(4-hydroxyphenyl)furan-2,5-dione |
|---|---|
| PubChem CID | 46930026 |
| Molecular Formula | C22H20O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-4-(4-hydroxyphenyl)furan-2,5-dione |
| SMILES | CC(C)=CCc1cc(CC2=C(c3ccc(O)cc3)C(=O)OC2=O)ccc1O |
| InChI | InChI=1S/C22H20O5/c1-13(2)3-5-16-11-14(4-10-19(16)24)12-18-20(22(26)27-21(18)25)15-6-8-17(23)9-7-15/h3-4,6-11,23-24H,5,12H2,1-2H3 |
| InChIKey | BFDQKBYABNXUJF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|