C23H18BrN3O3S — CID 4693057
9-bromo-2-(4-methylsulfanylphenyl)-5-(3-nitrophenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 4693057) has the molecular formula C23H18BrN3O3S and a molecular weight of 496.39 g/mol. Its IUPAC name is 9-bromo-2-(4-methylsulfanylphenyl)-5-(3-nitrophenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | 9-bromo-2-(4-methylsulfanylphenyl)-5-(3-nitrophenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 4693057 |
| Molecular Formula | C23H18BrN3O3S |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 9-bromo-2-(4-methylsulfanylphenyl)-5-(3-nitrophenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | CSc1ccc(C2=NN3C(C2)c2cc(Br)ccc2OC3c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H18BrN3O3S/c1-31-18-8-5-14(6-9-18)20-13-21-19-12-16(24)7-10-22(19)30-23(26(21)25-20)15-3-2-4-17(11-15)27(28)29/h2-12,21,23H,13H2,1H3 |
| InChIKey | OYVGSWYAUUGEKM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|