C22H30O4 — CID 46930683
[(3aS,5Z,7S,10E,14E,15aS)-6,10,14-trimethyl-3-methylidene-2-oxo-3a,4,7,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-7-yl] acetate (PubChem CID 46930683) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(3aS,5Z,7S,10E,14E,15aS)-6,10,14-trimethyl-3-methylidene-2-oxo-3a,4,7,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-7-yl] acetate.
| Compound Name | [(3aS,5Z,7S,10E,14E,15aS)-6,10,14-trimethyl-3-methylidene-2-oxo-3a,4,7,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-7-yl] acetate |
|---|---|
| PubChem CID | 46930683 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(3aS,5Z,7S,10E,14E,15aS)-6,10,14-trimethyl-3-methylidene-2-oxo-3a,4,7,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-7-yl] acetate |
| SMILES | C=C1C(=O)O[C@H]2/C=C(\C)CC/C=C(\C)CC[C@H](OC(C)=O)/C(C)=C\C[C@@H]12 |
| InChI | InChI=1S/C22H30O4/c1-14-7-6-8-15(2)13-21-19(17(4)22(24)26-21)11-10-16(3)20(12-9-14)25-18(5)23/h7,10,13,19-21H,4,6,8-9,11-12H2,1-3,5H3/b14-7+,15-13+,16-10-/t19-,20-,21-/m0/s1 |
| InChIKey | LJCSRCAUWHVUAP-LFKIRVIUSA-N |
| XLogP | 4.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|