C29H43NO4SSi — CID 46930857
(S)-N-[(1S)-1-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 46930857) has the molecular formula C29H43NO4SSi and a molecular weight of 529.82 g/mol. Its IUPAC name is (S)-N-[(1S)-1-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1S)-1-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 46930857 |
| Molecular Formula | C29H43NO4SSi |
| Molecular Weight | 529.82 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | (S)-N-[(1S)-1-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=C[C@H](N[S@@](=O)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H43NO4SSi/c1-10-24(30-35(31)27(2,3)4)26-25(33-29(8,9)34-26)21-32-36(28(5,6)7,22-17-13-11-14-18-22)23-19-15-12-16-20-23/h10-20,24-26,30H,1,21H2,2-9H3/t24-,25-,26-,35-/m0/s1 |
| InChIKey | XCXMDTWLRGYJPH-BNGFFDTHSA-N |
| XLogP | 4.69 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.82 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|