C23H23NO3S — CID 46930863
1-[(2R,3R)-1-(benzenesulfonyl)-3-naphthalen-2-ylaziridin-2-yl]pentan-1-one (PubChem CID 46930863) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is 1-[(2R,3R)-1-(benzenesulfonyl)-3-naphthalen-2-ylaziridin-2-yl]pentan-1-one.
| Compound Name | 1-[(2R,3R)-1-(benzenesulfonyl)-3-naphthalen-2-ylaziridin-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 46930863 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-[(2R,3R)-1-(benzenesulfonyl)-3-naphthalen-2-ylaziridin-2-yl]pentan-1-one |
| SMILES | CCCCC(=O)[C@H]1[C@@H](c2ccc3ccccc3c2)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H23NO3S/c1-2-3-13-21(25)23-22(19-15-14-17-9-7-8-10-18(17)16-19)24(23)28(26,27)20-11-5-4-6-12-20/h4-12,14-16,22-23H,2-3,13H2,1H3/t22-,23+,24?/m1/s1 |
| InChIKey | FYHKMBYHWMEWRF-NHIDMIJISA-N |
| XLogP | 4.71 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|