About ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate
ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate (PubChem CID 46930891) has the molecular formula C20H18N2O4
and a molecular weight of 350.37 g/mol. Its IUPAC name is ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate |
| PubChem CID | 46930891 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(c2ccc(O)cc2C#N)N=C(c2ccccc2)O[C@@H]1C |
| InChI | InChI=1S/C20H18N2O4/c1-3-25-19(24)20(17-10-9-16(23)11-15(17)12-21)13(2)26-18(22-20)14-7-5-4-6-8-14/h4-11,13,23H,3H2,1-2H3/t13-,20+/m1/s1 |
| InChIKey | AKRQITKRQWWCLX-XCLFUZPHSA-N |
| XLogP | 2.89 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate (CID 46930891) is ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate is CCOC(=O)[C@]1(c2ccc(O)cc2C#N)N=C(c2ccccc2)O[C@@H]1C.
What is the InChIKey of ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate?
The InChIKey is AKRQITKRQWWCLX-XCLFUZPHSA-N. The full InChI is InChI=1S/C20H18N2O4/c1-3-25-19(24)20(17-10-9-16(23)11-15(17)12-21)13(2)26-18(22-20)14-7-5-4-6-8-14/h4-11,13,23H,3H2,1-2H3/t13-,20+/m1/s1.
What are the key properties of ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate?
ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate has a molecular weight of 350.37 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4R,5R)-4-(2-cyano-4-hydroxyphenyl)-5-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 46930891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).