C22H23N2O3PS2 — CID 46930973
(1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenyl-sulfanylidene-λ5-phosphane;methanesulfonate (PubChem CID 46930973) has the molecular formula C22H23N2O3PS2 and a molecular weight of 458.55 g/mol. Its IUPAC name is (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenyl-sulfanylidene-λ5-phosphane;methanesulfonate.
| Compound Name | (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenyl-sulfanylidene-λ5-phosphane;methanesulfonate |
|---|---|
| PubChem CID | 46930973 |
| Molecular Formula | C22H23N2O3PS2 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenyl-sulfanylidene-λ5-phosphane;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].Cc1c(P(=S)(c2ccccc2)c2ccccc2)[n+]2ccccc2n1C |
| InChI | InChI=1S/C21H20N2PS.CH4O3S/c1-17-21(23-16-10-9-15-20(23)22(17)2)24(25,18-11-5-3-6-12-18)19-13-7-4-8-14-19;1-5(2,3)4/h3-16H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | BQUUUOOBUWAQSJ-UHFFFAOYSA-M |
| XLogP | 1.99 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|