C33H32F3N2O2PS — CID 46930978
[2-methyl-1-(5-phenylpentyl)imidazo[1,2-a]pyridin-4-ium-3-yl]-diphenyl-sulfanylidene-λ5-phosphane;2,2,2-trifluoroacetate (PubChem CID 46930978) has the molecular formula C33H32F3N2O2PS and a molecular weight of 608.67 g/mol. Its IUPAC name is [2-methyl-1-(5-phenylpentyl)imidazo[1,2-a]pyridin-4-ium-3-yl]-diphenyl-sulfanylidene-λ5-phosphane;2,2,2-trifluoroacetate.
| Compound Name | [2-methyl-1-(5-phenylpentyl)imidazo[1,2-a]pyridin-4-ium-3-yl]-diphenyl-sulfanylidene-λ5-phosphane;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 46930978 |
| Molecular Formula | C33H32F3N2O2PS |
| Molecular Weight | 608.67 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | [2-methyl-1-(5-phenylpentyl)imidazo[1,2-a]pyridin-4-ium-3-yl]-diphenyl-sulfanylidene-λ5-phosphane;2,2,2-trifluoroacetate |
| SMILES | Cc1c(P(=S)(c2ccccc2)c2ccccc2)[n+]2ccccc2n1CCCCCc1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C31H32N2PS.C2HF3O2/c1-26-31(34(35,28-19-9-3-10-20-28)29-21-11-4-12-22-29)33-25-15-13-23-30(33)32(26)24-14-5-8-18-27-16-6-2-7-17-27;3-2(4,5)1(6)7/h2-4,6-7,9-13,15-17,19-23,25H,5,8,14,18,24H2,1H3;(H,6,7)/q+1;/p-1 |
| InChIKey | OQXRAUGVENHHIF-UHFFFAOYSA-M |
| XLogP | 5.00 |
| TPSA | 49.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|