C18H20O4 — CID 46931209
1-[(E)-2-(2,6-dimethoxyphenyl)ethenyl]-2,4-dimethoxybenzene (PubChem CID 46931209) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 1-[(E)-2-(2,6-dimethoxyphenyl)ethenyl]-2,4-dimethoxybenzene.
| Compound Name | 1-[(E)-2-(2,6-dimethoxyphenyl)ethenyl]-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 46931209 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-[(E)-2-(2,6-dimethoxyphenyl)ethenyl]-2,4-dimethoxybenzene |
| SMILES | COc1ccc(/C=C/c2c(OC)cccc2OC)c(OC)c1 |
| InChI | InChI=1S/C18H20O4/c1-19-14-10-8-13(18(12-14)22-4)9-11-15-16(20-2)6-5-7-17(15)21-3/h5-12H,1-4H3/b11-9+ |
| InChIKey | ATUGWMZMPPCPIP-PKNBQFBNSA-N |
| XLogP | 3.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|