C24H21FN8O4 — CID 46931353
(E)-but-2-enedioic acid;2-N-(4-fluorophenyl)-4-N-phenyl-6-N-(pyrimidin-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 46931353) has the molecular formula C24H21FN8O4 and a molecular weight of 504.48 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-N-(4-fluorophenyl)-4-N-phenyl-6-N-(pyrimidin-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | (E)-but-2-enedioic acid;2-N-(4-fluorophenyl)-4-N-phenyl-6-N-(pyrimidin-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 46931353 |
| Molecular Formula | C24H21FN8O4 |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (E)-but-2-enedioic acid;2-N-(4-fluorophenyl)-4-N-phenyl-6-N-(pyrimidin-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | Fc1ccc(Nc2nc(NCc3ncccn3)nc(Nc3ccccc3)n2)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H17FN8.C4H4O4/c21-14-7-9-16(10-8-14)26-20-28-18(24-13-17-22-11-4-12-23-17)27-19(29-20)25-15-5-2-1-3-6-15;5-3(6)1-2-4(7)8/h1-12H,13H2,(H3,24,25,26,27,28,29);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | VKDVNTUJGRQWSX-WLHGVMLRSA-N |
| XLogP | 3.61 |
| TPSA | 175.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|