C7H17N4O5PS2 — CID 46931398
[[(2R)-1-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]-1-oxopropan-2-yl]amino]methylphosphonic acid (PubChem CID 46931398) has the molecular formula C7H17N4O5PS2 and a molecular weight of 332.34 g/mol. Its IUPAC name is [[(2R)-1-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]-1-oxopropan-2-yl]amino]methylphosphonic acid.
| Compound Name | [[(2R)-1-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]-1-oxopropan-2-yl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 46931398 |
| Molecular Formula | C7H17N4O5PS2 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | [[(2R)-1-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]-1-oxopropan-2-yl]amino]methylphosphonic acid |
| SMILES | NC(=O)C(N)CSSC[C@H](NCP(=O)(O)O)C(N)=O |
| InChI | InChI=1S/C7H17N4O5PS2/c8-4(6(9)12)1-18-19-2-5(7(10)13)11-3-17(14,15)16/h4-5,11H,1-3,8H2,(H2,9,12)(H2,10,13)(H2,14,15,16)/t4?,5-/m0/s1 |
| InChIKey | LTLAQMMKJQDWAB-AKGZTFGVSA-N |
| XLogP | -2.24 |
| TPSA | 181.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|