C10H7F6N5O — CID 46931700
4-(2,2,3,4,4,4-hexafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 46931700) has the molecular formula C10H7F6N5O and a molecular weight of 327.19 g/mol. Its IUPAC name is 4-(2,2,3,4,4,4-hexafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 4-(2,2,3,4,4,4-hexafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 46931700 |
| Molecular Formula | C10H7F6N5O |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 4-(2,2,3,4,4,4-hexafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | FC(C(F)(F)F)C(F)(F)COc1cc(-n2cncn2)ncn1 |
| InChI | InChI=1S/C10H7F6N5O/c11-8(10(14,15)16)9(12,13)2-22-7-1-6(18-4-19-7)21-5-17-3-20-21/h1,3-5,8H,2H2 |
| InChIKey | KSLWNVLHJCFGGJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |