C25H24ClN7O — CID 46931717
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine (PubChem CID 46931717) has the molecular formula C25H24ClN7O and a molecular weight of 473.97 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine |
|---|---|
| PubChem CID | 46931717 |
| Molecular Formula | C25H24ClN7O |
| Molecular Weight | 473.97 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-9-[(4-methoxyphenyl)methyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine |
| SMILES | COc1ccc(CN2CCc3[nH]nc4nc(NCCc5c[nH]c6ccc(Cl)cc56)nc2c34)cc1 |
| InChI | InChI=1S/C25H24ClN7O/c1-34-18-5-2-15(3-6-18)14-33-11-9-21-22-23(32-31-21)29-25(30-24(22)33)27-10-8-16-13-28-20-7-4-17(26)12-19(16)20/h2-7,12-13,28H,8-11,14H2,1H3,(H2,27,29,30,31,32) |
| InChIKey | SUKPPWABVMGNQA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.97 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |