C29H29NO4S — CID 46932096
N-[6-(5-benzoyl-3-tert-butyl-2-methoxyphenyl)naphthalen-2-yl]methanesulfonamide (PubChem CID 46932096) has the molecular formula C29H29NO4S and a molecular weight of 487.62 g/mol. Its IUPAC name is N-[6-(5-benzoyl-3-tert-butyl-2-methoxyphenyl)naphthalen-2-yl]methanesulfonamide.
| Compound Name | N-[6-(5-benzoyl-3-tert-butyl-2-methoxyphenyl)naphthalen-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 46932096 |
| Molecular Formula | C29H29NO4S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | N-[6-(5-benzoyl-3-tert-butyl-2-methoxyphenyl)naphthalen-2-yl]methanesulfonamide |
| SMILES | COc1c(-c2ccc3cc(NS(C)(=O)=O)ccc3c2)cc(C(=O)c2ccccc2)cc1C(C)(C)C |
| InChI | InChI=1S/C29H29NO4S/c1-29(2,3)26-18-23(27(31)19-9-7-6-8-10-19)17-25(28(26)34-4)22-12-11-21-16-24(30-35(5,32)33)14-13-20(21)15-22/h6-18,30H,1-5H3 |
| InChIKey | QSKABYUZGCZCFD-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |