C22H32ClNO — CID 46932395
1-[5-(1-adamantyl)-5-phenyloxolan-3-yl]-N-methylmethanamine;hydrochloride (PubChem CID 46932395) has the molecular formula C22H32ClNO and a molecular weight of 361.96 g/mol. Its IUPAC name is 1-[5-(1-adamantyl)-5-phenyloxolan-3-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[5-(1-adamantyl)-5-phenyloxolan-3-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 46932395 |
| Molecular Formula | C22H32ClNO |
| Molecular Weight | 361.96 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-[5-(1-adamantyl)-5-phenyloxolan-3-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCC1COC(c2ccccc2)(C23CC4CC(CC(C4)C2)C3)C1.Cl |
| InChI | InChI=1S/C22H31NO.ClH/c1-23-14-19-13-22(24-15-19,20-5-3-2-4-6-20)21-10-16-7-17(11-21)9-18(8-16)12-21;/h2-6,16-19,23H,7-15H2,1H3;1H |
| InChIKey | OMRSKLUDPXSWSX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.96 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |