C20H25N4O5P — CID 46932496
[4-[4-(4-amino-7,7-dimethylpyrimido[4,5-b][1,4]oxazin-6-yl)phenyl]cyclohexyl] dihydrogen phosphate (PubChem CID 46932496) has the molecular formula C20H25N4O5P and a molecular weight of 432.42 g/mol. Its IUPAC name is [4-[4-(4-amino-7,7-dimethylpyrimido[4,5-b][1,4]oxazin-6-yl)phenyl]cyclohexyl] dihydrogen phosphate.
| Compound Name | [4-[4-(4-amino-7,7-dimethylpyrimido[4,5-b][1,4]oxazin-6-yl)phenyl]cyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 46932496 |
| Molecular Formula | C20H25N4O5P |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [4-[4-(4-amino-7,7-dimethylpyrimido[4,5-b][1,4]oxazin-6-yl)phenyl]cyclohexyl] dihydrogen phosphate |
| SMILES | CC1(C)Oc2ncnc(N)c2N=C1c1ccc(C2CCC(OP(=O)(O)O)CC2)cc1 |
| InChI | InChI=1S/C20H25N4O5P/c1-20(2)17(24-16-18(21)22-11-23-19(16)28-20)14-5-3-12(4-6-14)13-7-9-15(10-8-13)29-30(25,26)27/h3-6,11,13,15H,7-10H2,1-2H3,(H2,21,22,23)(H2,25,26,27) |
| InChIKey | CDVBFMVKVYLCKE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|