C24H18ClF3N4O3S — CID 46932821
4-[2-chloro-5-(trifluoromethyl)phenyl]-9-(4-methylphenyl)sulfonyl-3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),11,13-tetraen-5-one (PubChem CID 46932821) has the molecular formula C24H18ClF3N4O3S and a molecular weight of 534.95 g/mol. Its IUPAC name is 4-[2-chloro-5-(trifluoromethyl)phenyl]-9-(4-methylphenyl)sulfonyl-3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),11,13-tetraen-5-one.
| Compound Name | 4-[2-chloro-5-(trifluoromethyl)phenyl]-9-(4-methylphenyl)sulfonyl-3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),11,13-tetraen-5-one |
|---|---|
| PubChem CID | 46932821 |
| Molecular Formula | C24H18ClF3N4O3S |
| Molecular Weight | 534.95 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | 4-[2-chloro-5-(trifluoromethyl)phenyl]-9-(4-methylphenyl)sulfonyl-3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),11,13-tetraen-5-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3c([nH]n(-c4cc(C(F)(F)F)ccc4Cl)c3=O)-c3cccnc32)cc1 |
| InChI | InChI=1S/C24H18ClF3N4O3S/c1-14-4-7-16(8-5-14)36(34,35)31-12-10-18-21(17-3-2-11-29-22(17)31)30-32(23(18)33)20-13-15(24(26,27)28)6-9-19(20)25/h2-9,11,13,30H,10,12H2,1H3 |
| InChIKey | YYDYNTDXTRUJQW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.95 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |