C15H12F3NS — CID 46932957
(4-methylphenyl) 2,2,2-trifluoro-N-phenylethanimidothioate (PubChem CID 46932957) has the molecular formula C15H12F3NS and a molecular weight of 295.33 g/mol. Its IUPAC name is (4-methylphenyl) 2,2,2-trifluoro-N-phenylethanimidothioate.
| Compound Name | (4-methylphenyl) 2,2,2-trifluoro-N-phenylethanimidothioate |
|---|---|
| PubChem CID | 46932957 |
| Molecular Formula | C15H12F3NS |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | (4-methylphenyl) 2,2,2-trifluoro-N-phenylethanimidothioate |
| SMILES | Cc1ccc(S/C(=N/c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12F3NS/c1-11-7-9-13(10-8-11)20-14(15(16,17)18)19-12-5-3-2-4-6-12/h2-10H,1H3/b19-14+ |
| InChIKey | SIERTEHBQDEURH-XMHGGMMESA-N |
| XLogP | 5.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|