C12H15NO — CID 46932960
(E)-N-methoxy-4-methyl-3,4-dihydro-2H-naphthalen-1-imine (PubChem CID 46932960) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (E)-N-methoxy-4-methyl-3,4-dihydro-2H-naphthalen-1-imine.
| Compound Name | (E)-N-methoxy-4-methyl-3,4-dihydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 46932960 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (E)-N-methoxy-4-methyl-3,4-dihydro-2H-naphthalen-1-imine |
| SMILES | CO/N=C1\CCC(C)c2ccccc21 |
| InChI | InChI=1S/C12H15NO/c1-9-7-8-12(13-14-2)11-6-4-3-5-10(9)11/h3-6,9H,7-8H2,1-2H3/b13-12+ |
| InChIKey | DKBAJMNNOBTLPY-OUKQBFOZSA-N |
| XLogP | 2.93 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|