About 8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid
8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid (PubChem CID 46933149) has the molecular formula C23H13NO5S
and a molecular weight of 415.43 g/mol. Its IUPAC name is 8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid.
Molecular Properties
| Compound Name | 8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid |
| PubChem CID | 46933149 |
| Molecular Formula | C23H13NO5S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2nc(-c3ccc4oc5c(C(=O)O)cccc5c4c3)cs2)cc1 |
| InChI | InChI=1S/C23H13NO5S/c25-22(26)13-6-4-12(5-7-13)21-24-18(11-30-21)14-8-9-19-17(10-14)15-2-1-3-16(23(27)28)20(15)29-19/h1-11H,(H,25,26)(H,27,28) |
| InChIKey | OLLCUWXYFSWOKO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid?
The IUPAC name of 8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid (CID 46933149) is 8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid.
What is the SMILES notation for 8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid?
The canonical SMILES for 8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid is O=C(O)c1ccc(-c2nc(-c3ccc4oc5c(C(=O)O)cccc5c4c3)cs2)cc1.
What is the InChIKey of 8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid?
The InChIKey is OLLCUWXYFSWOKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13NO5S/c25-22(26)13-6-4-12(5-7-13)21-24-18(11-30-21)14-8-9-19-17(10-14)15-2-1-3-16(23(27)28)20(15)29-19/h1-11H,(H,25,26)(H,27,28).
What are the key properties of 8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid?
8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid has a molecular weight of 415.43 g/mol, XLogP of 5.77, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[2-(4-carboxyphenyl)-1,3-thiazol-4-yl]dibenzofuran-4-carboxylic acid is sourced from PubChem (CID 46933149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).