C15H25NO3 — CID 46933255
tert-butyl (2S,4R,6R)-4-ethenyl-6-methyl-2-prop-2-enyl-1,3-oxazinane-3-carboxylate (PubChem CID 46933255) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl (2S,4R,6R)-4-ethenyl-6-methyl-2-prop-2-enyl-1,3-oxazinane-3-carboxylate.
| Compound Name | tert-butyl (2S,4R,6R)-4-ethenyl-6-methyl-2-prop-2-enyl-1,3-oxazinane-3-carboxylate |
|---|---|
| PubChem CID | 46933255 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | tert-butyl (2S,4R,6R)-4-ethenyl-6-methyl-2-prop-2-enyl-1,3-oxazinane-3-carboxylate |
| SMILES | C=CC[C@@H]1O[C@H](C)C[C@H](C=C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO3/c1-7-9-13-16(14(17)19-15(4,5)6)12(8-2)10-11(3)18-13/h7-8,11-13H,1-2,9-10H2,3-6H3/t11-,12+,13+/m1/s1 |
| InChIKey | JATAKPVDSPMWJO-AGIUHOORSA-N |
| XLogP | 3.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|