C15H11N3O2 — CID 46933599
5-methyl-5,6-dihydrobenzimidazolo[2,1-f][1,6]naphthyridine-8,11-dione (PubChem CID 46933599) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 5-methyl-5,6-dihydrobenzimidazolo[2,1-f][1,6]naphthyridine-8,11-dione.
| Compound Name | 5-methyl-5,6-dihydrobenzimidazolo[2,1-f][1,6]naphthyridine-8,11-dione |
|---|---|
| PubChem CID | 46933599 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 5-methyl-5,6-dihydrobenzimidazolo[2,1-f][1,6]naphthyridine-8,11-dione |
| SMILES | CC1Cn2c(nc3c2C(=O)C=CC3=O)-c2cccnc21 |
| InChI | InChI=1S/C15H11N3O2/c1-8-7-18-14-11(20)5-4-10(19)13(14)17-15(18)9-3-2-6-16-12(8)9/h2-6,8H,7H2,1H3 |
| InChIKey | PYDPSQIVZPKFCA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|