About 6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione
6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione (PubChem CID 46933613) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione.
Molecular Properties
| Compound Name | 6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione |
| PubChem CID | 46933613 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione |
| SMILES | CCCC1CC12NC(=O)N(C)C2=O |
| InChI | InChI=1S/C9H14N2O2/c1-3-4-6-5-9(6)7(12)11(2)8(13)10-9/h6H,3-5H2,1-2H3,(H,10,13) |
| InChIKey | QNHUTHDYYCEIJA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione?
The IUPAC name of 6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione (CID 46933613) is 6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione.
What is the SMILES notation for 6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione?
The canonical SMILES for 6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione is CCCC1CC12NC(=O)N(C)C2=O.
What is the InChIKey of 6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione?
The InChIKey is QNHUTHDYYCEIJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-3-4-6-5-9(6)7(12)11(2)8(13)10-9/h6H,3-5H2,1-2H3,(H,10,13).
What are the key properties of 6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione?
6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione has a molecular weight of 182.22 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-propyl-4,6-diazaspiro[2.4]heptane-5,7-dione is sourced from PubChem (CID 46933613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).