About N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide
N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide (PubChem CID 46933658) has the molecular formula C15H13N3O2S2
and a molecular weight of 331.42 g/mol. Its IUPAC name is N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide |
| PubChem CID | 46933658 |
| Molecular Formula | C15H13N3O2S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1nnc(-c2ccccc2)s1)Nc1ccccc1 |
| InChI | InChI=1S/C15H13N3O2S2/c19-22(20,18-13-9-5-2-6-10-13)11-14-16-17-15(21-14)12-7-3-1-4-8-12/h1-10,18H,11H2 |
| InChIKey | ARMQTXUYSUPJKR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide?
The IUPAC name of N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide (CID 46933658) is N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide.
What is the SMILES notation for N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide?
The canonical SMILES for N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide is O=S(=O)(Cc1nnc(-c2ccccc2)s1)Nc1ccccc1.
What is the InChIKey of N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide?
The InChIKey is ARMQTXUYSUPJKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O2S2/c19-22(20,18-13-9-5-2-6-10-13)11-14-16-17-15(21-14)12-7-3-1-4-8-12/h1-10,18H,11H2.
What are the key properties of N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide?
N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide has a molecular weight of 331.42 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-1-(5-phenyl-1,3,4-thiadiazol-2-yl)methanesulfonamide is sourced from PubChem (CID 46933658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).