C22H29N3O2 — CID 46933690
6-[ethyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]-N-hydroxypyridine-3-carboxamide (PubChem CID 46933690) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 6-[ethyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]-N-hydroxypyridine-3-carboxamide.
| Compound Name | 6-[ethyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]-N-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 46933690 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 6-[ethyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]-N-hydroxypyridine-3-carboxamide |
| SMILES | CCN(c1ccc2c(c1)C(C)(C)CCC2(C)C)c1ccc(C(=O)NO)cn1 |
| InChI | InChI=1S/C22H29N3O2/c1-6-25(19-10-7-15(14-23-19)20(26)24-27)16-8-9-17-18(13-16)22(4,5)12-11-21(17,2)3/h7-10,13-14,27H,6,11-12H2,1-5H3,(H,24,26) |
| InChIKey | CILQIUGLRXYMHJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|