C36H48O8 — CID 46933696
(1R,6E,13R,15S,16R,17S)-15-octoxy-16,17-bis(phenylmethoxy)-2,11,14-trioxabicyclo[11.4.0]heptadec-6-ene-3,10-dione (PubChem CID 46933696) has the molecular formula C36H48O8 and a molecular weight of 608.77 g/mol. Its IUPAC name is (1R,6E,13R,15S,16R,17S)-15-octoxy-16,17-bis(phenylmethoxy)-2,11,14-trioxabicyclo[11.4.0]heptadec-6-ene-3,10-dione.
| Compound Name | (1R,6E,13R,15S,16R,17S)-15-octoxy-16,17-bis(phenylmethoxy)-2,11,14-trioxabicyclo[11.4.0]heptadec-6-ene-3,10-dione |
|---|---|
| PubChem CID | 46933696 |
| Molecular Formula | C36H48O8 |
| Molecular Weight | 608.77 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | (1R,6E,13R,15S,16R,17S)-15-octoxy-16,17-bis(phenylmethoxy)-2,11,14-trioxabicyclo[11.4.0]heptadec-6-ene-3,10-dione |
| SMILES | CCCCCCCCO[C@H]1O[C@@H]2COC(=O)CC/C=C/CCC(=O)O[C@H]2[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H48O8/c1-2-3-4-5-8-17-24-39-36-35(42-26-29-20-13-10-14-21-29)34(41-25-28-18-11-9-12-19-28)33-30(43-36)27-40-31(37)22-15-6-7-16-23-32(38)44-33/h6-7,9-14,18-21,30,33-36H,2-5,8,15-17,22-27H2,1H3/b7-6+/t30-,33-,34+,35-,36+/m1/s1 |
| InChIKey | WVKDNFAROTUEIR-RZNOYIFPSA-N |
| XLogP | 6.84 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.77 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|