C20H32N2O2 — CID 46933820
(NE)-N-[(E)-4-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-[(2E)-2-hydroxyiminoethyl]but-2-enylidene]hydroxylamine (PubChem CID 46933820) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is (NE)-N-[(E)-4-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-[(2E)-2-hydroxyiminoethyl]but-2-enylidene]hydroxylamine.
| Compound Name | (NE)-N-[(E)-4-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-[(2E)-2-hydroxyiminoethyl]but-2-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 46933820 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | (NE)-N-[(E)-4-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-[(2E)-2-hydroxyiminoethyl]but-2-enylidene]hydroxylamine |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C/C=C(/C=N/O)C/C=N/O |
| InChI | InChI=1S/C20H32N2O2/c1-15-6-9-18-19(2,3)11-5-12-20(18,4)17(15)8-7-16(14-22-24)10-13-21-23/h7,13-14,17-18,23-24H,1,5-6,8-12H2,2-4H3/b16-7+,21-13+,22-14+/t17-,18-,20+/m0/s1 |
| InChIKey | VCWSGZIUEXMLCB-RSLJXMQYSA-N |
| XLogP | 5.41 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|