C15H20O5 — CID 46933997
(1S,4R,5R,5aR,6R)-1,4,6-trihydroxy-5,7,7-trimethyl-1,4,5,5a,6,8-hexahydroazuleno[5,6-c]furan-3-one (PubChem CID 46933997) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (1S,4R,5R,5aR,6R)-1,4,6-trihydroxy-5,7,7-trimethyl-1,4,5,5a,6,8-hexahydroazuleno[5,6-c]furan-3-one.
| Compound Name | (1S,4R,5R,5aR,6R)-1,4,6-trihydroxy-5,7,7-trimethyl-1,4,5,5a,6,8-hexahydroazuleno[5,6-c]furan-3-one |
|---|---|
| PubChem CID | 46933997 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1S,4R,5R,5aR,6R)-1,4,6-trihydroxy-5,7,7-trimethyl-1,4,5,5a,6,8-hexahydroazuleno[5,6-c]furan-3-one |
| SMILES | C[C@@H]1[C@@H]2C(=CC3=C(C(=O)O[C@@H]3O)[C@@H]1O)CC(C)(C)[C@@H]2O |
| InChI | InChI=1S/C15H20O5/c1-6-9-7(5-15(2,3)12(9)17)4-8-10(11(6)16)14(19)20-13(8)18/h4,6,9,11-13,16-18H,5H2,1-3H3/t6-,9-,11-,12-,13+/m1/s1 |
| InChIKey | JPUWZJIHLKKYKJ-FXBUQDJQSA-N |
| XLogP | 0.50 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |