About 2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol
2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol (PubChem CID 46934043) has the molecular formula C14H9F2NO3
and a molecular weight of 277.23 g/mol. Its IUPAC name is 2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol.
Molecular Properties
| Compound Name | 2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol |
| PubChem CID | 46934043 |
| Molecular Formula | C14H9F2NO3 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol |
| SMILES | Oc1cccc2oc(COc3c(F)cccc3F)nc12 |
| InChI | InChI=1S/C14H9F2NO3/c15-8-3-1-4-9(16)14(8)19-7-12-17-13-10(18)5-2-6-11(13)20-12/h1-6,18H,7H2 |
| InChIKey | FUWOYNOTANOIMB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol?
The IUPAC name of 2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol (CID 46934043) is 2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol.
What is the SMILES notation for 2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol?
The canonical SMILES for 2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol is Oc1cccc2oc(COc3c(F)cccc3F)nc12.
What is the InChIKey of 2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol?
The InChIKey is FUWOYNOTANOIMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F2NO3/c15-8-3-1-4-9(16)14(8)19-7-12-17-13-10(18)5-2-6-11(13)20-12/h1-6,18H,7H2.
What are the key properties of 2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol?
2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol has a molecular weight of 277.23 g/mol, XLogP of 3.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-difluorophenoxy)methyl]-1,3-benzoxazol-4-ol is sourced from PubChem (CID 46934043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).