C21H35NO2 — CID 46934068
N-butyl-N-[(1R,2R,4E,8E)-2,6,6,9-tetramethyl-3-oxocycloundeca-4,8-dien-1-yl]acetamide (PubChem CID 46934068) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is N-butyl-N-[(1R,2R,4E,8E)-2,6,6,9-tetramethyl-3-oxocycloundeca-4,8-dien-1-yl]acetamide.
| Compound Name | N-butyl-N-[(1R,2R,4E,8E)-2,6,6,9-tetramethyl-3-oxocycloundeca-4,8-dien-1-yl]acetamide |
|---|---|
| PubChem CID | 46934068 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | N-butyl-N-[(1R,2R,4E,8E)-2,6,6,9-tetramethyl-3-oxocycloundeca-4,8-dien-1-yl]acetamide |
| SMILES | CCCCN(C(C)=O)[C@@H]1CC/C(C)=C/CC(C)(C)/C=C/C(=O)[C@@H]1C |
| InChI | InChI=1S/C21H35NO2/c1-7-8-15-22(18(4)23)19-10-9-16(2)11-13-21(5,6)14-12-20(24)17(19)3/h11-12,14,17,19H,7-10,13,15H2,1-6H3/b14-12+,16-11+/t17-,19-/m1/s1 |
| InChIKey | QUPBUBNBAHIKBJ-ZSJKDNDCSA-N |
| XLogP | 4.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|