C19H35NO — CID 46934069
(1S,2E,6E,10R,11R)-10-(butylamino)-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-ol (PubChem CID 46934069) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is (1S,2E,6E,10R,11R)-10-(butylamino)-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-ol.
| Compound Name | (1S,2E,6E,10R,11R)-10-(butylamino)-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-ol |
|---|---|
| PubChem CID | 46934069 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | (1S,2E,6E,10R,11R)-10-(butylamino)-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-ol |
| SMILES | CCCCN[C@@H]1CC/C(C)=C/CC(C)(C)/C=C/[C@H](O)[C@@H]1C |
| InChI | InChI=1S/C19H35NO/c1-6-7-14-20-17-9-8-15(2)10-12-19(4,5)13-11-18(21)16(17)3/h10-11,13,16-18,20-21H,6-9,12,14H2,1-5H3/b13-11+,15-10+/t16-,17-,18+/m1/s1 |
| InChIKey | CCVITBTWVUMCIE-RTYMONHUSA-N |
| XLogP | 4.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|