C17H29NO2 — CID 46934070
N-[(1R,2R,3S,4E,8E)-3-hydroxy-2,6,6,9-tetramethylcycloundeca-4,8-dien-1-yl]acetamide (PubChem CID 46934070) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is N-[(1R,2R,3S,4E,8E)-3-hydroxy-2,6,6,9-tetramethylcycloundeca-4,8-dien-1-yl]acetamide.
| Compound Name | N-[(1R,2R,3S,4E,8E)-3-hydroxy-2,6,6,9-tetramethylcycloundeca-4,8-dien-1-yl]acetamide |
|---|---|
| PubChem CID | 46934070 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | N-[(1R,2R,3S,4E,8E)-3-hydroxy-2,6,6,9-tetramethylcycloundeca-4,8-dien-1-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CC/C(C)=C/CC(C)(C)/C=C/[C@H](O)[C@@H]1C |
| InChI | InChI=1S/C17H29NO2/c1-12-6-7-15(18-14(3)19)13(2)16(20)9-11-17(4,5)10-8-12/h8-9,11,13,15-16,20H,6-7,10H2,1-5H3,(H,18,19)/b11-9+,12-8+/t13-,15-,16+/m1/s1 |
| InChIKey | KHMCSZVZRFEYNK-RLHSEHTHSA-N |
| XLogP | 3.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|