C17H35IO3Si — CID 46934166
tert-butyl-[(Z,2S,3R,4S)-6-iodo-3-(methoxymethoxy)-2,4-dimethylhept-5-enoxy]-dimethylsilane (PubChem CID 46934166) has the molecular formula C17H35IO3Si and a molecular weight of 442.45 g/mol. Its IUPAC name is tert-butyl-[(Z,2S,3R,4S)-6-iodo-3-(methoxymethoxy)-2,4-dimethylhept-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,2S,3R,4S)-6-iodo-3-(methoxymethoxy)-2,4-dimethylhept-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 46934166 |
| Molecular Formula | C17H35IO3Si |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | tert-butyl-[(Z,2S,3R,4S)-6-iodo-3-(methoxymethoxy)-2,4-dimethylhept-5-enoxy]-dimethylsilane |
| SMILES | COCO[C@H]([C@@H](C)/C=C(/C)I)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H35IO3Si/c1-13(10-15(3)18)16(20-12-19-7)14(2)11-21-22(8,9)17(4,5)6/h10,13-14,16H,11-12H2,1-9H3/b15-10-/t13-,14-,16+/m0/s1 |
| InChIKey | XXTUZIVPDPRFQF-SJBPLCOISA-N |
| XLogP | 5.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|