C16H11N5O2S2 — CID 46934678
5-[4-[2-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)anilino]phenyl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 46934678) has the molecular formula C16H11N5O2S2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 5-[4-[2-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)anilino]phenyl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[4-[2-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)anilino]phenyl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 46934678 |
| Molecular Formula | C16H11N5O2S2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 5-[4-[2-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)anilino]phenyl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(-c2ccc(Nc3ccccc3-c3n[nH]c(=S)o3)cc2)o1 |
| InChI | InChI=1S/C16H11N5O2S2/c24-15-20-18-13(22-15)9-5-7-10(8-6-9)17-12-4-2-1-3-11(12)14-19-21-16(25)23-14/h1-8,17H,(H,20,24)(H,21,25) |
| InChIKey | ZLOOVLLHZRGDQK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|