C23H25NO4S — CID 46934686
2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium;4-methylbenzenesulfonate (PubChem CID 46934686) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is 2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium;4-methylbenzenesulfonate.
| Compound Name | 2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 46934686 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium;4-methylbenzenesulfonate |
| SMILES | CCOc1ccc(/C=C/c2cccc[n+]2C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C16H18NO.C7H8O3S/c1-3-18-16-11-8-14(9-12-16)7-10-15-6-4-5-13-17(15)2;1-6-2-4-7(5-3-6)11(8,9)10/h4-13H,3H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1/b10-7+; |
| InChIKey | PCVKDZATUOHJTI-HCUGZAAXSA-M |
| XLogP | 3.98 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|