About N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide
N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide (PubChem CID 46934722) has the molecular formula C15H14FN3O3
and a molecular weight of 303.29 g/mol. Its IUPAC name is N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide.
Molecular Properties
| Compound Name | N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide |
| PubChem CID | 46934722 |
| Molecular Formula | C15H14FN3O3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide |
| SMILES | O=C(NC/C=C\Cn1ccc(=O)[nH]c1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H14FN3O3/c16-12-5-3-11(4-6-12)14(21)17-8-1-2-9-19-10-7-13(20)18-15(19)22/h1-7,10H,8-9H2,(H,17,21)(H,18,20,22)/b2-1- |
| InChIKey | WYNQKSSMYJEICL-UPHRSURJSA-N |
| XLogP | 0.66 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide?
The IUPAC name of N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide (CID 46934722) is N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide.
What is the SMILES notation for N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide?
The canonical SMILES for N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide is O=C(NC/C=C\Cn1ccc(=O)[nH]c1=O)c1ccc(F)cc1.
What is the InChIKey of N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide?
The InChIKey is WYNQKSSMYJEICL-UPHRSURJSA-N. The full InChI is InChI=1S/C15H14FN3O3/c16-12-5-3-11(4-6-12)14(21)17-8-1-2-9-19-10-7-13(20)18-15(19)22/h1-7,10H,8-9H2,(H,17,21)(H,18,20,22)/b2-1-.
What are the key properties of N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide?
N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide has a molecular weight of 303.29 g/mol, XLogP of 0.66, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-4-fluorobenzamide is sourced from PubChem (CID 46934722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).