C38H42N6O7 — CID 46934726
5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-[4-methyl-3-[[4-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]amino]phenyl]pentanamide (PubChem CID 46934726) has the molecular formula C38H42N6O7 and a molecular weight of 694.79 g/mol. Its IUPAC name is 5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-[4-methyl-3-[[4-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]amino]phenyl]pentanamide.
| Compound Name | 5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-[4-methyl-3-[[4-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]amino]phenyl]pentanamide |
|---|---|
| PubChem CID | 46934726 |
| Molecular Formula | C38H42N6O7 |
| Molecular Weight | 694.79 g/mol |
| Exact Mass | 694.31 |
| IUPAC Name | 5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-[4-methyl-3-[[4-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]amino]phenyl]pentanamide |
| SMILES | COc1cc2c(cc1OCCCCC(=O)Nc1ccc(C)c(Nc3nccc(-c4cc(OC)c(OC)c(OC)c4)n3)c1)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C38H42N6O7/c1-23-11-12-25(19-29(23)43-38-39-14-13-28(42-38)24-17-33(48-3)36(50-5)34(18-24)49-4)41-35(45)10-6-7-16-51-32-21-30-27(20-31(32)47-2)37(46)44-15-8-9-26(44)22-40-30/h11-14,17-22,26H,6-10,15-16H2,1-5H3,(H,41,45)(H,39,42,43)/t26-/m0/s1 |
| InChIKey | PCOWZEJWSOPVMR-SANMLTNESA-N |
| XLogP | 6.74 |
| TPSA | 145.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.79 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|