About [(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate
[(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate (PubChem CID 46934737) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is [(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate.
Molecular Properties
| Compound Name | [(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate |
| PubChem CID | 46934737 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate |
| SMILES | CC(C)CCC[C@@](C)(O)CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H26O3/c1-14(2)8-7-11-17(3,19)12-13-20-16(18)15-9-5-4-6-10-15/h4-6,9-10,14,19H,7-8,11-13H2,1-3H3/t17-/m1/s1 |
| InChIKey | ULBOPHTXADFUBM-QGZVFWFLSA-N |
| XLogP | 3.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate?
The IUPAC name of [(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate (CID 46934737) is [(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate.
What is the SMILES notation for [(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate?
The canonical SMILES for [(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate is CC(C)CCC[C@@](C)(O)CCOC(=O)c1ccccc1.
What is the InChIKey of [(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate?
The InChIKey is ULBOPHTXADFUBM-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H26O3/c1-14(2)8-7-11-17(3,19)12-13-20-16(18)15-9-5-4-6-10-15/h4-6,9-10,14,19H,7-8,11-13H2,1-3H3/t17-/m1/s1.
What are the key properties of [(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate?
[(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate has a molecular weight of 278.39 g/mol, XLogP of 3.81, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-hydroxy-3,7-dimethyloctyl] benzoate is sourced from PubChem (CID 46934737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).