About 4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium
4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium (PubChem CID 46934831) has the molecular formula C22H24N2O4S
and a molecular weight of 412.51 g/mol. Its IUPAC name is 4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium.
Molecular Properties
| Compound Name | 4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium |
| PubChem CID | 46934831 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium |
| SMILES | CCOc1ccc(/C=C/c2cccc[n+]2C)cc1.Nc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C16H18NO.C6H7NO3S/c1-3-18-16-11-8-14(9-12-16)7-10-15-6-4-5-13-17(15)2;7-5-1-3-6(4-2-5)11(8,9)10/h4-13H,3H2,1-2H3;1-4H,7H2,(H,8,9,10)/q+1;/p-1/b10-7+; |
| InChIKey | SYIBFNVDZIEQBP-HCUGZAAXSA-M |
| XLogP | 3.25 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium?
The IUPAC name of 4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium (CID 46934831) is 4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium.
What is the SMILES notation for 4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium?
The canonical SMILES for 4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium is CCOc1ccc(/C=C/c2cccc[n+]2C)cc1.Nc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium?
The InChIKey is SYIBFNVDZIEQBP-HCUGZAAXSA-M. The full InChI is InChI=1S/C16H18NO.C6H7NO3S/c1-3-18-16-11-8-14(9-12-16)7-10-15-6-4-5-13-17(15)2;7-5-1-3-6(4-2-5)11(8,9)10/h4-13H,3H2,1-2H3;1-4H,7H2,(H,8,9,10)/q+1;/p-1/b10-7+;.
What are the key properties of 4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium?
4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium has a molecular weight of 412.51 g/mol, XLogP of 3.25, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium is sourced from PubChem (CID 46934831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).