C18H14N6O6S — CID 46935202
2-(5-nitroindazol-1-yl)-N-[2-(2-nitrophenyl)-4-oxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 46935202) has the molecular formula C18H14N6O6S and a molecular weight of 442.41 g/mol. Its IUPAC name is 2-(5-nitroindazol-1-yl)-N-[2-(2-nitrophenyl)-4-oxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | 2-(5-nitroindazol-1-yl)-N-[2-(2-nitrophenyl)-4-oxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 46935202 |
| Molecular Formula | C18H14N6O6S |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 2-(5-nitroindazol-1-yl)-N-[2-(2-nitrophenyl)-4-oxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(Cn1ncc2cc([N+](=O)[O-])ccc21)NN1C(=O)CSC1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14N6O6S/c25-16(9-21-14-6-5-12(23(27)28)7-11(14)8-19-21)20-22-17(26)10-31-18(22)13-3-1-2-4-15(13)24(29)30/h1-8,18H,9-10H2,(H,20,25) |
| InChIKey | CLGINEXJLMRDSY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 153.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|