C14H23N2O7P — CID 46936443
(2S,3R)-2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylamino]-3-methylpentanoic acid (PubChem CID 46936443) has the molecular formula C14H23N2O7P and a molecular weight of 362.32 g/mol. Its IUPAC name is (2S,3R)-2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylamino]-3-methylpentanoic acid.
| Compound Name | (2S,3R)-2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 46936443 |
| Molecular Formula | C14H23N2O7P |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (2S,3R)-2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylamino]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@H](NCc1c(COP(=O)(O)O)cnc(C)c1O)C(=O)O |
| InChI | InChI=1S/C14H23N2O7P/c1-4-8(2)12(14(18)19)16-6-11-10(7-23-24(20,21)22)5-15-9(3)13(11)17/h5,8,12,16-17H,4,6-7H2,1-3H3,(H,18,19)(H2,20,21,22)/t8-,12+/m1/s1 |
| InChIKey | GZZDWFDWHXPWJK-PELKAZGASA-N |
| XLogP | 1.29 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|