About (4S)-4-aminohexanoic acid
(4S)-4-aminohexanoic acid (PubChem CID 46936928) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is (4S)-4-aminohexanoic acid.
Molecular Properties
| Compound Name | (4S)-4-aminohexanoic acid |
| PubChem CID | 46936928 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (4S)-4-aminohexanoic acid |
| SMILES | CC[C@H](N)CCC(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-2-5(7)3-4-6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | ROFNJLCLYMMXCT-YFKPBYRVSA-N |
| XLogP | 0.59 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-aminohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-aminohexanoic acid?
The IUPAC name of (4S)-4-aminohexanoic acid (CID 46936928) is (4S)-4-aminohexanoic acid.
What is the SMILES notation for (4S)-4-aminohexanoic acid?
The canonical SMILES for (4S)-4-aminohexanoic acid is CC[C@H](N)CCC(=O)O.
What is the InChIKey of (4S)-4-aminohexanoic acid?
The InChIKey is ROFNJLCLYMMXCT-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H13NO2/c1-2-5(7)3-4-6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1.
What are the key properties of (4S)-4-aminohexanoic acid?
(4S)-4-aminohexanoic acid has a molecular weight of 131.18 g/mol, XLogP of 0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-aminohexanoic acid is sourced from PubChem (CID 46936928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).