About (1S,4R,5R)-3,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid
(1S,4R,5R)-3,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid (PubChem CID 46936953) has the molecular formula C7H10O5
and a molecular weight of 174.15 g/mol. Its IUPAC name is (1S,4R,5R)-3,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid.
Analyze (1S,4R,5R)-3,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4R,5R)-3,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid?
The IUPAC name of (1S,4R,5R)-3,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid (CID 46936953) is (1S,4R,5R)-3,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid.
What is the SMILES notation for (1S,4R,5R)-3,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid?
The canonical SMILES for (1S,4R,5R)-3,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid is O=C(O)[C@@H]1C=C(O)[C@H](O)[C@H](O)C1.
What is the InChIKey of (1S,4R,5R)-3,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid?
The InChIKey is YVYKOQWMJZXRRM-PUFIMZNGSA-N. The full InChI is InChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,3,5-6,8-10H,2H2,(H,11,12)/t3-,5-,6+/m1/s1.
What are the key properties of (1S,4R,5R)-3,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid?
(1S,4R,5R)-3,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid has a molecular weight of 174.15 g/mol, XLogP of -0.75, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4R,5R)-3,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid is sourced from PubChem (CID 46936953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).