C20H39NO8 — CID 46937064
(2S,3S,4S,6S)-6-[(2R,3R,4S,5R,6R)-4-amino-5-hydroxy-6-(hydroxymethyl)-2-octoxyoxan-3-yl]oxy-2-methyloxane-3,4-diol (PubChem CID 46937064) has the molecular formula C20H39NO8 and a molecular weight of 421.53 g/mol. Its IUPAC name is (2S,3S,4S,6S)-6-[(2R,3R,4S,5R,6R)-4-amino-5-hydroxy-6-(hydroxymethyl)-2-octoxyoxan-3-yl]oxy-2-methyloxane-3,4-diol.
| Compound Name | (2S,3S,4S,6S)-6-[(2R,3R,4S,5R,6R)-4-amino-5-hydroxy-6-(hydroxymethyl)-2-octoxyoxan-3-yl]oxy-2-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 46937064 |
| Molecular Formula | C20H39NO8 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | (2S,3S,4S,6S)-6-[(2R,3R,4S,5R,6R)-4-amino-5-hydroxy-6-(hydroxymethyl)-2-octoxyoxan-3-yl]oxy-2-methyloxane-3,4-diol |
| SMILES | CCCCCCCCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](N)[C@H]1O[C@H]1C[C@H](O)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C20H39NO8/c1-3-4-5-6-7-8-9-26-20-19(16(21)18(25)14(11-22)28-20)29-15-10-13(23)17(24)12(2)27-15/h12-20,22-25H,3-11,21H2,1-2H3/t12-,13-,14+,15-,16-,17+,18-,19+,20+/m0/s1 |
| InChIKey | GHTLMVRROQXELT-HTYYFBMYSA-N |
| XLogP | 0.01 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|