About 4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol
4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol (PubChem CID 46937065) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol.
Molecular Properties
| Compound Name | 4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol |
| PubChem CID | 46937065 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol |
| SMILES | N[C@H](CC[C@@H](N)O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C11H18N2O2/c12-9(3-6-11(13)15)7-8-1-4-10(14)5-2-8/h1-2,4-5,9,11,14-15H,3,6-7,12-13H2/t9-,11+/m1/s1 |
| InChIKey | VTBBVHAOBBELOH-KOLCDFICSA-N |
| XLogP | 0.32 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol?
The IUPAC name of 4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol (CID 46937065) is 4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol.
What is the SMILES notation for 4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol?
The canonical SMILES for 4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol is N[C@H](CC[C@@H](N)O)Cc1ccc(O)cc1.
What is the InChIKey of 4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol?
The InChIKey is VTBBVHAOBBELOH-KOLCDFICSA-N. The full InChI is InChI=1S/C11H18N2O2/c12-9(3-6-11(13)15)7-8-1-4-10(14)5-2-8/h1-2,4-5,9,11,14-15H,3,6-7,12-13H2/t9-,11+/m1/s1.
What are the key properties of 4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol?
4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol has a molecular weight of 210.28 g/mol, XLogP of 0.32, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,5S)-2,5-diamino-5-hydroxypentyl]phenol is sourced from PubChem (CID 46937065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).